C21H20Cl3N5O2S2 — CID 18726380
S-(2-phenylethyl) N-[2-oxo-1-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamothioate (PubChem CID 18726380) has the molecular formula C21H20Cl3N5O2S2 and a molecular weight of 544.92 g/mol. Its IUPAC name is S-(2-phenylethyl) N-[2-oxo-1-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamothioate.
| Compound Name | S-(2-phenylethyl) N-[2-oxo-1-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamothioate |
|---|---|
| PubChem CID | 18726380 |
| Molecular Formula | C21H20Cl3N5O2S2 |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | S-(2-phenylethyl) N-[2-oxo-1-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamothioate |
| SMILES | CCC(NC(=O)SCCc1ccccc1)C(=O)Cn1nnnc1Sc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C21H20Cl3N5O2S2/c1-2-16(25-21(31)32-11-10-13-6-4-3-5-7-13)17(30)12-29-20(26-27-28-29)33-19-15(23)9-8-14(22)18(19)24/h3-9,16H,2,10-12H2,1H3,(H,25,31) |
| InChIKey | QQKZKLVGDXASFX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|