About butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate
butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate (PubChem CID 18726310) has the molecular formula C19H24Cl2N6O4S
and a molecular weight of 503.41 g/mol. Its IUPAC name is butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate.
Molecular Properties
| Compound Name | butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
| PubChem CID | 18726310 |
| Molecular Formula | C19H24Cl2N6O4S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
| SMILES | CCCCOC(=O)NC(CC)C(=O)Cn1nnnc1Sc1c(Cl)cc(NC(C)=O)cc1Cl |
| InChI | InChI=1S/C19H24Cl2N6O4S/c1-4-6-7-31-19(30)23-15(5-2)16(29)10-27-18(24-25-26-27)32-17-13(20)8-12(9-14(17)21)22-11(3)28/h8-9,15H,4-7,10H2,1-3H3,(H,22,28)(H,23,30) |
| InChIKey | UFNSCIYSQAHFBG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate?
The IUPAC name of butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate (CID 18726310) is butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate.
What is the SMILES notation for butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate?
The canonical SMILES for butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate is CCCCOC(=O)NC(CC)C(=O)Cn1nnnc1Sc1c(Cl)cc(NC(C)=O)cc1Cl.
What is the InChIKey of butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate?
The InChIKey is UFNSCIYSQAHFBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Cl2N6O4S/c1-4-6-7-31-19(30)23-15(5-2)16(29)10-27-18(24-25-26-27)32-17-13(20)8-12(9-14(17)21)22-11(3)28/h8-9,15H,4-7,10H2,1-3H3,(H,22,28)(H,23,30).
What are the key properties of butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate?
butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate has a molecular weight of 503.41 g/mol, XLogP of 3.96, 11 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate is sourced from PubChem (CID 18726310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).