C19H24Cl2N6O4S — CID 18726310
butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate (PubChem CID 18726310) has the molecular formula C19H24Cl2N6O4S and a molecular weight of 503.41 g/mol. Its IUPAC name is butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate.
| Compound Name | butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 18726310 |
| Molecular Formula | C19H24Cl2N6O4S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | butyl N-[1-[5-(4-acetamido-2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
| SMILES | CCCCOC(=O)NC(CC)C(=O)Cn1nnnc1Sc1c(Cl)cc(NC(C)=O)cc1Cl |
| InChI | InChI=1S/C19H24Cl2N6O4S/c1-4-6-7-31-19(30)23-15(5-2)16(29)10-27-18(24-25-26-27)32-17-13(20)8-12(9-14(17)21)22-11(3)28/h8-9,15H,4-7,10H2,1-3H3,(H,22,28)(H,23,30) |
| InChIKey | UFNSCIYSQAHFBG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|