C22H24ClN5O3 — CID 18726228
benzyl N-[1-[5-[2-(4-chlorophenyl)ethyl]tetrazol-1-yl]-2-oxopentan-3-yl]carbamate (PubChem CID 18726228) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is benzyl N-[1-[5-[2-(4-chlorophenyl)ethyl]tetrazol-1-yl]-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[1-[5-[2-(4-chlorophenyl)ethyl]tetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 18726228 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | benzyl N-[1-[5-[2-(4-chlorophenyl)ethyl]tetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
| SMILES | CCC(NC(=O)OCc1ccccc1)C(=O)Cn1nnnc1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClN5O3/c1-2-19(24-22(30)31-15-17-6-4-3-5-7-17)20(29)14-28-21(25-26-27-28)13-10-16-8-11-18(23)12-9-16/h3-9,11-12,19H,2,10,13-15H2,1H3,(H,24,30) |
| InChIKey | KYSLERBRKGNEEL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |