C24H29N5O4 — CID 18726151
benzyl N-[1-[5-(3-tert-butylphenoxy)tetrazol-1-yl]-2-oxopentan-3-yl]carbamate (PubChem CID 18726151) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is benzyl N-[1-[5-(3-tert-butylphenoxy)tetrazol-1-yl]-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[1-[5-(3-tert-butylphenoxy)tetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 18726151 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | benzyl N-[1-[5-(3-tert-butylphenoxy)tetrazol-1-yl]-2-oxopentan-3-yl]carbamate |
| SMILES | CCC(NC(=O)OCc1ccccc1)C(=O)Cn1nnnc1Oc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H29N5O4/c1-5-20(25-23(31)32-16-17-10-7-6-8-11-17)21(30)15-29-22(26-27-28-29)33-19-13-9-12-18(14-19)24(2,3)4/h6-14,20H,5,15-16H2,1-4H3,(H,25,31) |
| InChIKey | KTANUMKTKXKCGD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |