C20H18BrFN2O3S — CID 23285798
N-[4-[1-[5-(4-bromobenzoyl)-1H-pyrrol-2-yl]ethyl]-3-fluorophenyl]methanesulfonamide (PubChem CID 23285798) has the molecular formula C20H18BrFN2O3S and a molecular weight of 465.34 g/mol. Its IUPAC name is N-[4-[1-[5-(4-bromobenzoyl)-1H-pyrrol-2-yl]ethyl]-3-fluorophenyl]methanesulfonamide.
| Compound Name | N-[4-[1-[5-(4-bromobenzoyl)-1H-pyrrol-2-yl]ethyl]-3-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 23285798 |
| Molecular Formula | C20H18BrFN2O3S |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | N-[4-[1-[5-(4-bromobenzoyl)-1H-pyrrol-2-yl]ethyl]-3-fluorophenyl]methanesulfonamide |
| SMILES | CC(c1ccc(C(=O)c2ccc(Br)cc2)[nH]1)c1ccc(NS(C)(=O)=O)cc1F |
| InChI | InChI=1S/C20H18BrFN2O3S/c1-12(16-8-7-15(11-17(16)22)24-28(2,26)27)18-9-10-19(23-18)20(25)13-3-5-14(21)6-4-13/h3-12,23-24H,1-2H3 |
| InChIKey | ZTTRTWZWANIHFV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |