C21H22FN3O4S — CID 23286042
2-(4-ethoxybenzoyl)-5-[1-[2-fluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole (PubChem CID 23286042) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-(4-ethoxybenzoyl)-5-[1-[2-fluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole.
| Compound Name | 2-(4-ethoxybenzoyl)-5-[1-[2-fluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole |
|---|---|
| PubChem CID | 23286042 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-(4-ethoxybenzoyl)-5-[1-[2-fluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole |
| SMILES | CCOc1ccc(C(=O)c2ccc(C(C)c3ccc(NS(N)(=O)=O)cc3F)[nH]2)cc1 |
| InChI | InChI=1S/C21H22FN3O4S/c1-3-29-16-7-4-14(5-8-16)21(26)20-11-10-19(24-20)13(2)17-9-6-15(12-18(17)22)25-30(23,27)28/h4-13,24-25H,3H2,1-2H3,(H2,23,27,28) |
| InChIKey | ZJTPOWSXJHHQQD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |