C19H17F2N3O3S — CID 70257412
2-benzoyl-5-[1-[2,3-difluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole (PubChem CID 70257412) has the molecular formula C19H17F2N3O3S and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-benzoyl-5-[1-[2,3-difluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole.
| Compound Name | 2-benzoyl-5-[1-[2,3-difluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole |
|---|---|
| PubChem CID | 70257412 |
| Molecular Formula | C19H17F2N3O3S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-benzoyl-5-[1-[2,3-difluoro-4-(sulfamoylamino)phenyl]ethyl]-1H-pyrrole |
| SMILES | CC(c1ccc(C(=O)c2ccccc2)[nH]1)c1ccc(NS(N)(=O)=O)c(F)c1F |
| InChI | InChI=1S/C19H17F2N3O3S/c1-11(13-7-8-15(18(21)17(13)20)24-28(22,26)27)14-9-10-16(23-14)19(25)12-5-3-2-4-6-12/h2-11,23-24H,1H3,(H2,22,26,27) |
| InChIKey | LIENMCUIFDOECR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |