About tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate
tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate (PubChem CID 67899517) has the molecular formula C37H25N3O9
and a molecular weight of 655.62 g/mol. Its IUPAC name is tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate.
Molecular Properties
| Compound Name | tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate |
| PubChem CID | 67899517 |
| Molecular Formula | C37H25N3O9 |
| Molecular Weight | 655.62 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)C(C(=O)Oc2ccc(C(=O)c3ccccc3)[nH]2)C(=O)Oc2ccc(C(=O)c3ccccc3)[nH]2)[nH]1 |
| InChI | InChI=1S/C37H25N3O9/c41-32(22-10-4-1-5-11-22)25-16-19-28(38-25)47-35(44)31(36(45)48-29-20-17-26(39-29)33(42)23-12-6-2-7-13-23)37(46)49-30-21-18-27(40-30)34(43)24-14-8-3-9-15-24/h1-21,31,38-40H |
| InChIKey | ISNMAROQRAJYEX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 177.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate?
The IUPAC name of tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate (CID 67899517) is tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate.
What is the SMILES notation for tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate?
The canonical SMILES for tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate is O=C(c1ccccc1)c1ccc(OC(=O)C(C(=O)Oc2ccc(C(=O)c3ccccc3)[nH]2)C(=O)Oc2ccc(C(=O)c3ccccc3)[nH]2)[nH]1.
What is the InChIKey of tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate?
The InChIKey is ISNMAROQRAJYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H25N3O9/c41-32(22-10-4-1-5-11-22)25-16-19-28(38-25)47-35(44)31(36(45)48-29-20-17-26(39-29)33(42)23-12-6-2-7-13-23)37(46)49-30-21-18-27(40-30)34(43)24-14-8-3-9-15-24/h1-21,31,38-40H.
What are the key properties of tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate?
tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate has a molecular weight of 655.62 g/mol, XLogP of 5.10, 12 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tris(5-benzoyl-1H-pyrrol-2-yl) methanetricarboxylate is sourced from PubChem (CID 67899517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).