C10H7NOS2 — CID 22266960
phenyl-(2-sulfanylidene-3H-1,3-thiazol-4-yl)methanone (PubChem CID 22266960) has the molecular formula C10H7NOS2 and a molecular weight of 221.31 g/mol. Its IUPAC name is phenyl-(2-sulfanylidene-3H-1,3-thiazol-4-yl)methanone.
| Compound Name | phenyl-(2-sulfanylidene-3H-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 22266960 |
| Molecular Formula | C10H7NOS2 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | phenyl-(2-sulfanylidene-3H-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1ccccc1)c1csc(=S)[nH]1 |
| InChI | InChI=1S/C10H7NOS2/c12-9(7-4-2-1-3-5-7)8-6-14-10(13)11-8/h1-6H,(H,11,13) |
| InChIKey | YWLANGHEWDGCHY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|