C14H9NOS2 — CID 71336948
phenyl-(2-sulfanylidene-3H-1,3-benzothiazol-7-yl)methanone (PubChem CID 71336948) has the molecular formula C14H9NOS2 and a molecular weight of 271.37 g/mol. Its IUPAC name is phenyl-(2-sulfanylidene-3H-1,3-benzothiazol-7-yl)methanone.
| Compound Name | phenyl-(2-sulfanylidene-3H-1,3-benzothiazol-7-yl)methanone |
|---|---|
| PubChem CID | 71336948 |
| Molecular Formula | C14H9NOS2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | phenyl-(2-sulfanylidene-3H-1,3-benzothiazol-7-yl)methanone |
| SMILES | O=C(c1ccccc1)c1cccc2[nH]c(=S)sc12 |
| InChI | InChI=1S/C14H9NOS2/c16-12(9-5-2-1-3-6-9)10-7-4-8-11-13(10)18-14(17)15-11/h1-8H,(H,15,17) |
| InChIKey | JWCIQBVUQMKIGO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|