About 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone
9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone (PubChem CID 162206940) has the molecular formula C33H25NO
and a molecular weight of 451.57 g/mol. Its IUPAC name is 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone.
Molecular Properties
| Compound Name | 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone |
| PubChem CID | 162206940 |
| Molecular Formula | C33H25NO |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1)c1ccccc1C=Cc1ccccc1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C21H16O.C12H9N/c22-21(19-12-5-2-6-13-19)20-14-8-7-11-18(20)16-15-17-9-3-1-4-10-17;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-16H;1-8,13H |
| InChIKey | ZSHXKIPVPRAFPP-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone?
The IUPAC name of 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone (CID 162206940) is 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone.
What is the SMILES notation for 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone?
The canonical SMILES for 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone is O=C(c1ccccc1)c1ccccc1C=Cc1ccccc1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone?
The InChIKey is ZSHXKIPVPRAFPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O.C12H9N/c22-21(19-12-5-2-6-13-19)20-14-8-7-11-18(20)16-15-17-9-3-1-4-10-17;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-16H;1-8,13H.
What are the key properties of 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone?
9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone has a molecular weight of 451.57 g/mol, XLogP of 8.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;phenyl-[2-(2-phenylethenyl)phenyl]methanone is sourced from PubChem (CID 162206940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).