C18H16O — CID 173151442
[2-(3-methylbuta-1,3-dienyl)phenyl]-phenylmethanone (PubChem CID 173151442) has the molecular formula C18H16O and a molecular weight of 248.32 g/mol. Its IUPAC name is [2-(3-methylbuta-1,3-dienyl)phenyl]-phenylmethanone.
| Compound Name | [2-(3-methylbuta-1,3-dienyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 173151442 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [2-(3-methylbuta-1,3-dienyl)phenyl]-phenylmethanone |
| SMILES | C=C(C)C=Cc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16O/c1-14(2)12-13-15-8-6-7-11-17(15)18(19)16-9-4-3-5-10-16/h3-13H,1H2,2H3 |
| InChIKey | GXRNGKBCHTUOJR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|