C21H40O3 — CID 23286533
2-hydroxyethyl 6,10,14-trimethyl-2-methylidenepentadecanoate (PubChem CID 23286533) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is 2-hydroxyethyl 6,10,14-trimethyl-2-methylidenepentadecanoate.
| Compound Name | 2-hydroxyethyl 6,10,14-trimethyl-2-methylidenepentadecanoate |
|---|---|
| PubChem CID | 23286533 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 2-hydroxyethyl 6,10,14-trimethyl-2-methylidenepentadecanoate |
| SMILES | C=C(CCCC(C)CCCC(C)CCCC(C)C)C(=O)OCCO |
| InChI | InChI=1S/C21H40O3/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)21(23)24-16-15-22/h17-19,22H,5-16H2,1-4H3 |
| InChIKey | RWYLKRVLNLEFIP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|