C17H14F6N2O3 — CID 2328694
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-phenylurea (PubChem CID 2328694) has the molecular formula C17H14F6N2O3 and a molecular weight of 408.30 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-phenylurea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 2328694 |
| Molecular Formula | C17H14F6N2O3 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cc(OCC(F)(F)F)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F6N2O3/c18-16(19,20)9-27-13-6-12(7-14(8-13)28-10-17(21,22)23)25-15(26)24-11-4-2-1-3-5-11/h1-8H,9-10H2,(H2,24,25,26) |
| InChIKey | PXWNITNHJVSBTL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |