C19H18F6N2O4 — CID 2328695
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-ethoxyphenyl)urea (PubChem CID 2328695) has the molecular formula C19H18F6N2O4 and a molecular weight of 452.35 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 2328695 |
| Molecular Formula | C19H18F6N2O4 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H18F6N2O4/c1-2-29-14-5-3-12(4-6-14)26-17(28)27-13-7-15(30-10-18(20,21)22)9-16(8-13)31-11-19(23,24)25/h3-9H,2,10-11H2,1H3,(H2,26,27,28) |
| InChIKey | SGRDNVCTHUYPFW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |