C40H80O4Si2 — CID 23287446
bis(1-tert-butylcyclopentyl)-diethoxysilane;bis(2,3-dimethylcyclopentyl)-diethoxysilane (PubChem CID 23287446) has the molecular formula C40H80O4Si2 and a molecular weight of 681.25 g/mol. Its IUPAC name is bis(1-tert-butylcyclopentyl)-diethoxysilane;bis(2,3-dimethylcyclopentyl)-diethoxysilane.
| Compound Name | bis(1-tert-butylcyclopentyl)-diethoxysilane;bis(2,3-dimethylcyclopentyl)-diethoxysilane |
|---|---|
| PubChem CID | 23287446 |
| Molecular Formula | C40H80O4Si2 |
| Molecular Weight | 681.25 g/mol |
| Exact Mass | 680.56 |
| IUPAC Name | bis(1-tert-butylcyclopentyl)-diethoxysilane;bis(2,3-dimethylcyclopentyl)-diethoxysilane |
| SMILES | CCO[Si](OCC)(C1(C(C)(C)C)CCCC1)C1(C(C)(C)C)CCCC1.CCO[Si](OCC)(C1CCC(C)C1C)C1CCC(C)C1C |
| InChI | InChI=1S/C22H44O2Si.C18H36O2Si/c1-9-23-25(24-10-2,21(19(3,4)5)15-11-12-16-21)22(20(6,7)8)17-13-14-18-22;1-7-19-21(20-8-2,17-11-9-13(3)15(17)5)18-12-10-14(4)16(18)6/h9-18H2,1-8H3;13-18H,7-12H2,1-6H3 |
| InChIKey | JIYXDPOWGMNSOV-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.25 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|