C16H37N2O7S+ — CID 23288506
butyl-bis(2-hydroxyethyl)-(3-sulfopropyl)azanium;2-(trimethylazaniumyl)acetate (PubChem CID 23288506) has the molecular formula C16H37N2O7S+ and a molecular weight of 401.55 g/mol. Its IUPAC name is butyl-bis(2-hydroxyethyl)-(3-sulfopropyl)azanium;2-(trimethylazaniumyl)acetate.
| Compound Name | butyl-bis(2-hydroxyethyl)-(3-sulfopropyl)azanium;2-(trimethylazaniumyl)acetate |
|---|---|
| PubChem CID | 23288506 |
| Molecular Formula | C16H37N2O7S+ |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | butyl-bis(2-hydroxyethyl)-(3-sulfopropyl)azanium;2-(trimethylazaniumyl)acetate |
| SMILES | CCCC[N+](CCO)(CCO)CCCS(=O)(=O)O.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C11H25NO5S.C5H11NO2/c1-2-3-5-12(7-9-13,8-10-14)6-4-11-18(15,16)17;1-6(2,3)4-5(7)8/h13-14H,2-11H2,1H3;4H2,1-3H3/p+1 |
| InChIKey | GBNFEKFZWAGNSL-UHFFFAOYSA-O |
| XLogP | -1.69 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|