C28H31N3O7S — CID 23288619
3-[(4-tert-butylphenyl)sulfonylamino]-N-(cyanomethyl)-5-(2-hydroxyethoxy)-4-(2-methoxyphenoxy)benzamide (PubChem CID 23288619) has the molecular formula C28H31N3O7S and a molecular weight of 553.64 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)sulfonylamino]-N-(cyanomethyl)-5-(2-hydroxyethoxy)-4-(2-methoxyphenoxy)benzamide.
| Compound Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-(cyanomethyl)-5-(2-hydroxyethoxy)-4-(2-methoxyphenoxy)benzamide |
|---|---|
| PubChem CID | 23288619 |
| Molecular Formula | C28H31N3O7S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-(cyanomethyl)-5-(2-hydroxyethoxy)-4-(2-methoxyphenoxy)benzamide |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc(C(=O)NCC#N)cc1OCCO |
| InChI | InChI=1S/C28H31N3O7S/c1-28(2,3)20-9-11-21(12-10-20)39(34,35)31-22-17-19(27(33)30-14-13-29)18-25(37-16-15-32)26(22)38-24-8-6-5-7-23(24)36-4/h5-12,17-18,31-32H,14-16H2,1-4H3,(H,30,33) |
| InChIKey | DMXAUNQOFWKDJB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|