C20H17Cl2NO3 — CID 23291705
2-(aminomethyl)phenol;3-(3,4-dichlorophenoxy)benzaldehyde (PubChem CID 23291705) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-(aminomethyl)phenol;3-(3,4-dichlorophenoxy)benzaldehyde.
| Compound Name | 2-(aminomethyl)phenol;3-(3,4-dichlorophenoxy)benzaldehyde |
|---|---|
| PubChem CID | 23291705 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-(aminomethyl)phenol;3-(3,4-dichlorophenoxy)benzaldehyde |
| SMILES | NCc1ccccc1O.O=Cc1cccc(Oc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H8Cl2O2.C7H9NO/c14-12-5-4-11(7-13(12)15)17-10-3-1-2-9(6-10)8-16;8-5-6-3-1-2-4-7(6)9/h1-8H;1-4,9H,5,8H2 |
| InChIKey | GEUUQHQNJHPMSN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|