C18H22N2O3S3 — CID 23296043
1-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]-1-(1,3-thiazol-2-yl)propane-2-thione (PubChem CID 23296043) has the molecular formula C18H22N2O3S3 and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]-1-(1,3-thiazol-2-yl)propane-2-thione.
| Compound Name | 1-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]-1-(1,3-thiazol-2-yl)propane-2-thione |
|---|---|
| PubChem CID | 23296043 |
| Molecular Formula | C18H22N2O3S3 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)sulfonylpiperidin-2-yl]-1-(1,3-thiazol-2-yl)propane-2-thione |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2C(C(C)=S)c2nccs2)cc1 |
| InChI | InChI=1S/C18H22N2O3S3/c1-13(24)17(18-19-10-12-25-18)16-5-3-4-11-20(16)26(21,22)15-8-6-14(23-2)7-9-15/h6-10,12,16-17H,3-5,11H2,1-2H3 |
| InChIKey | ACAZZMWZSGFLHA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|