C25H18N4O3S — CID 23296521
N-[2-[2-(4-cyanophenyl)ethyl]-1,3-benzoxazol-5-yl]quinoline-8-sulfonamide (PubChem CID 23296521) has the molecular formula C25H18N4O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[2-[2-(4-cyanophenyl)ethyl]-1,3-benzoxazol-5-yl]quinoline-8-sulfonamide.
| Compound Name | N-[2-[2-(4-cyanophenyl)ethyl]-1,3-benzoxazol-5-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 23296521 |
| Molecular Formula | C25H18N4O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[2-[2-(4-cyanophenyl)ethyl]-1,3-benzoxazol-5-yl]quinoline-8-sulfonamide |
| SMILES | N#Cc1ccc(CCc2nc3cc(NS(=O)(=O)c4cccc5cccnc45)ccc3o2)cc1 |
| InChI | InChI=1S/C25H18N4O3S/c26-16-18-8-6-17(7-9-18)10-13-24-28-21-15-20(11-12-22(21)32-24)29-33(30,31)23-5-1-3-19-4-2-14-27-25(19)23/h1-9,11-12,14-15,29H,10,13H2 |
| InChIKey | PUOGLPBGZNWKEL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |