C22H33N5O — CID 23299985
5-cyclobutyl-2-methyl-4-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]pyrazol-3-amine (PubChem CID 23299985) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 5-cyclobutyl-2-methyl-4-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]pyrazol-3-amine.
| Compound Name | 5-cyclobutyl-2-methyl-4-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 23299985 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 5-cyclobutyl-2-methyl-4-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]pyrazol-3-amine |
| SMILES | CC(C)Oc1ccccc1N1CCN(Cc2c(C3CCC3)nn(C)c2N)CC1 |
| InChI | InChI=1S/C22H33N5O/c1-16(2)28-20-10-5-4-9-19(20)27-13-11-26(12-14-27)15-18-21(17-7-6-8-17)24-25(3)22(18)23/h4-5,9-10,16-17H,6-8,11-15,23H2,1-3H3 |
| InChIKey | IUVFIEAMFRWGNB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |