C24H30N4O3 — CID 10598329
5-[[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 10598329) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 5-[[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10598329 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 5-[[3-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | CC(C)Oc1ccccc1N1CCN(Cc2cccc(CC3NC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c1-17(2)31-22-9-4-3-8-21(22)28-12-10-27(11-13-28)16-19-7-5-6-18(14-19)15-20-23(29)26-24(30)25-20/h3-9,14,17,20H,10-13,15-16H2,1-2H3,(H2,25,26,29,30) |
| InChIKey | QCGLPBJBMLGTBV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|