C25H30N2O5 — CID 23301721
[4-[2-amino-3-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate (PubChem CID 23301721) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [4-[2-amino-3-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate.
| Compound Name | [4-[2-amino-3-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 23301721 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [4-[2-amino-3-(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)Oc1cc(C)c(CC(N)C(=O)N2CCCc3cc(OC)ccc32)c(C)c1 |
| InChI | InChI=1S/C25H30N2O5/c1-5-11-31-25(29)32-20-12-16(2)21(17(3)13-20)15-22(26)24(28)27-10-6-7-18-14-19(30-4)8-9-23(18)27/h5,8-9,12-14,22H,1,6-7,10-11,15,26H2,2-4H3 |
| InChIKey | JCLKSAAPENEKQW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|