C23H26N2O4 — CID 70255772
[4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate (PubChem CID 70255772) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate.
| Compound Name | [4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 70255772 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)Oc1cc(C)c(C(N)CC(=O)N2CCc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-4-11-28-23(27)29-18-12-15(2)22(16(3)13-18)19(24)14-21(26)25-10-9-17-7-5-6-8-20(17)25/h4-8,12-13,19H,1,9-11,14,24H2,2-3H3 |
| InChIKey | LBKIKZXBLCJROU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|