C19H19BrN2O4 — CID 70253678
[4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3-bromophenyl] methyl carbonate (PubChem CID 70253678) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is [4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3-bromophenyl] methyl carbonate.
| Compound Name | [4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3-bromophenyl] methyl carbonate |
|---|---|
| PubChem CID | 70253678 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [4-[1-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3-bromophenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(C(N)CC(=O)N2CCc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C19H19BrN2O4/c1-25-19(24)26-13-6-7-14(15(20)10-13)16(21)11-18(23)22-9-8-12-4-2-3-5-17(12)22/h2-7,10,16H,8-9,11,21H2,1H3 |
| InChIKey | RNRFVJVHZFFQFM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|