C23H27BrN2O4 — CID 57157732
[4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromo-5-methylphenyl] ethyl carbonate (PubChem CID 57157732) has the molecular formula C23H27BrN2O4 and a molecular weight of 475.38 g/mol. Its IUPAC name is [4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromo-5-methylphenyl] ethyl carbonate.
| Compound Name | [4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromo-5-methylphenyl] ethyl carbonate |
|---|---|
| PubChem CID | 57157732 |
| Molecular Formula | C23H27BrN2O4 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromo-5-methylphenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(C)c(C(N)CC(=O)N2CC(C)Cc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C23H27BrN2O4/c1-4-29-23(28)30-17-10-15(3)22(18(24)11-17)19(25)12-21(27)26-13-14(2)9-16-7-5-6-8-20(16)26/h5-8,10-11,14,19H,4,9,12-13,25H2,1-3H3 |
| InChIKey | SSAUTWDPQZNFLK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|