C24H30N2O4 — CID 23301641
[4-[2-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] ethyl carbonate (PubChem CID 23301641) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [4-[2-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] ethyl carbonate.
| Compound Name | [4-[2-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] ethyl carbonate |
|---|---|
| PubChem CID | 23301641 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [4-[2-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(C)c(CC(N)C(=O)N2CC(C)Cc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-5-29-24(28)30-19-11-16(3)20(17(4)12-19)13-21(25)23(27)26-14-15(2)10-18-8-6-7-9-22(18)26/h6-9,11-12,15,21H,5,10,13-14,25H2,1-4H3 |
| InChIKey | RGCMRASYCUSVSX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|