C23H25BrN2O4 — CID 57222880
[4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromophenyl] prop-2-enyl carbonate (PubChem CID 57222880) has the molecular formula C23H25BrN2O4 and a molecular weight of 473.37 g/mol. Its IUPAC name is [4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromophenyl] prop-2-enyl carbonate.
| Compound Name | [4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromophenyl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 57222880 |
| Molecular Formula | C23H25BrN2O4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [4-[1-amino-3-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-3-oxopropyl]-3-bromophenyl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)Oc1ccc(C(N)CC(=O)N2CC(C)Cc3ccccc32)c(Br)c1 |
| InChI | InChI=1S/C23H25BrN2O4/c1-3-10-29-23(28)30-17-8-9-18(19(24)12-17)20(25)13-22(27)26-14-15(2)11-16-6-4-5-7-21(16)26/h3-9,12,15,20H,1,10-11,13-14,25H2,2H3 |
| InChIKey | SCPJUSMVQIKRQZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|