C21H24N2O4 — CID 54026327
[4-[(2R)-2-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate (PubChem CID 54026327) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is [4-[(2R)-2-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate.
| Compound Name | [4-[(2R)-2-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate |
|---|---|
| PubChem CID | 54026327 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [4-[(2R)-2-amino-3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3,5-dimethylphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cc(C)c(C[C@@H](N)C(=O)N2CCc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-13-10-16(27-21(25)26-3)11-14(2)17(13)12-18(22)20(24)23-9-8-15-6-4-5-7-19(15)23/h4-7,10-11,18H,8-9,12,22H2,1-3H3/t18-/m1/s1 |
| InChIKey | LCLHZUPDLAWQEF-GOSISDBHSA-N |
| XLogP | 2.91 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|