C9H7ClFN5 — CID 23311127
6-(2-chloro-6-fluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 23311127) has the molecular formula C9H7ClFN5 and a molecular weight of 239.64 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 23311127 |
| Molecular Formula | C9H7ClFN5 |
| Molecular Weight | 239.64 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nnc(-c2c(F)cccc2Cl)c(N)n1 |
| InChI | InChI=1S/C9H7ClFN5/c10-4-2-1-3-5(11)6(4)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
| InChIKey | APXAGCNXBBJUPP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |