C13H10F2O4S — CID 23312058
4-(2,4-difluorophenyl)sulfonyl-5-methylbenzene-1,2-diol (PubChem CID 23312058) has the molecular formula C13H10F2O4S and a molecular weight of 300.28 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfonyl-5-methylbenzene-1,2-diol.
| Compound Name | 4-(2,4-difluorophenyl)sulfonyl-5-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 23312058 |
| Molecular Formula | C13H10F2O4S |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfonyl-5-methylbenzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)cc1S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H10F2O4S/c1-7-4-10(16)11(17)6-13(7)20(18,19)12-3-2-8(14)5-9(12)15/h2-6,16-17H,1H3 |
| InChIKey | PKRLBFJCSZSJKX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|