C33H26N4O13S4 — CID 23314378
5-hydroxy-1-[[4-[[4-[(5-hydroxy-2-sulfonaphthalen-1-yl)sulfamoyl]phenyl]carbamoylamino]phenyl]sulfonylamino]naphthalene-2-sulfonic acid (PubChem CID 23314378) has the molecular formula C33H26N4O13S4 and a molecular weight of 814.85 g/mol. Its IUPAC name is 5-hydroxy-1-[[4-[[4-[(5-hydroxy-2-sulfonaphthalen-1-yl)sulfamoyl]phenyl]carbamoylamino]phenyl]sulfonylamino]naphthalene-2-sulfonic acid.
| Compound Name | 5-hydroxy-1-[[4-[[4-[(5-hydroxy-2-sulfonaphthalen-1-yl)sulfamoyl]phenyl]carbamoylamino]phenyl]sulfonylamino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 23314378 |
| Molecular Formula | C33H26N4O13S4 |
| Molecular Weight | 814.85 g/mol |
| Exact Mass | 814.04 |
| IUPAC Name | 5-hydroxy-1-[[4-[[4-[(5-hydroxy-2-sulfonaphthalen-1-yl)sulfamoyl]phenyl]carbamoylamino]phenyl]sulfonylamino]naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2c(S(=O)(=O)O)ccc3c(O)cccc23)cc1)Nc1ccc(S(=O)(=O)Nc2c(S(=O)(=O)O)ccc3c(O)cccc23)cc1 |
| InChI | InChI=1S/C33H26N4O13S4/c38-27-5-1-3-25-23(27)15-17-29(53(45,46)47)31(25)36-51(41,42)21-11-7-19(8-12-21)34-33(40)35-20-9-13-22(14-10-20)52(43,44)37-32-26-4-2-6-28(39)24(26)16-18-30(32)54(48,49)50/h1-18,36-39H,(H2,34,35,40)(H,45,46,47)(H,48,49,50) |
| InChIKey | YUOYRWQQOFRWSC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 282.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|