C21H24F4O4 — CID 23314697
1-O-(2,2,3,3-tetrafluoropropyl) 2-O-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzene-1,2-dicarboxylate (PubChem CID 23314697) has the molecular formula C21H24F4O4 and a molecular weight of 416.41 g/mol. Its IUPAC name is 1-O-(2,2,3,3-tetrafluoropropyl) 2-O-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(2,2,3,3-tetrafluoropropyl) 2-O-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23314697 |
| Molecular Formula | C21H24F4O4 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-O-(2,2,3,3-tetrafluoropropyl) 2-O-[(1R,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzene-1,2-dicarboxylate |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)[C@H](OC(=O)c1ccccc1C(=O)OCC(F)(F)C(F)F)C2 |
| InChI | InChI=1S/C21H24F4O4/c1-19(2)12-8-9-20(19,3)15(10-12)29-17(27)14-7-5-4-6-13(14)16(26)28-11-21(24,25)18(22)23/h4-7,12,15,18H,8-11H2,1-3H3/t12-,15+,20-/m0/s1 |
| InChIKey | LITJOVYGBCQFMZ-VHPWJVAPSA-N |
| XLogP | 5.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|