C37H52Cl2N3O5S+ — CID 23317444
4-methyl-2-propan-2-yl-2-[2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-4H-1,2-benzothiazin-2-ium-3-one;dihydrochloride (PubChem CID 23317444) has the molecular formula C37H52Cl2N3O5S+ and a molecular weight of 721.81 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yl-2-[2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-4H-1,2-benzothiazin-2-ium-3-one;dihydrochloride.
| Compound Name | 4-methyl-2-propan-2-yl-2-[2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-4H-1,2-benzothiazin-2-ium-3-one;dihydrochloride |
|---|---|
| PubChem CID | 23317444 |
| Molecular Formula | C37H52Cl2N3O5S+ |
| Molecular Weight | 721.81 g/mol |
| Exact Mass | 720.30 |
| IUPAC Name | 4-methyl-2-propan-2-yl-2-[2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-4H-1,2-benzothiazin-2-ium-3-one;dihydrochloride |
| SMILES | COc1cc(CCN2CCN(CCCCOc3ccccc3[N+]3(C(C)C)Sc4ccccc4C(C)C3=O)CC2)cc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C37H50N3O5S.2ClH/c1-27(2)40(37(41)28(3)30-13-7-10-16-35(30)46-40)31-14-8-9-15-32(31)45-24-12-11-18-38-20-22-39(23-21-38)19-17-29-25-33(42-4)36(44-6)34(26-29)43-5;;/h7-10,13-16,25-28H,11-12,17-24H2,1-6H3;2*1H/q+1;; |
| InChIKey | MTOCQOZOEMFTFT-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.81 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|