C35H45ClN3O5S+ — CID 23317471
2-[5-chloro-2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one (PubChem CID 23317471) has the molecular formula C35H45ClN3O5S+ and a molecular weight of 655.28 g/mol. Its IUPAC name is 2-[5-chloro-2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one.
| Compound Name | 2-[5-chloro-2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one |
|---|---|
| PubChem CID | 23317471 |
| Molecular Formula | C35H45ClN3O5S+ |
| Molecular Weight | 655.28 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 2-[5-chloro-2-[4-[4-[2-(3,4,5-trimethoxyphenyl)ethyl]piperazin-1-yl]butoxy]phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one |
| SMILES | COc1cc(CCN2CCN(CCCCOc3ccc(Cl)cc3[N+]3(C)Sc4ccccc4C(C)C3=O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C35H45ClN3O5S/c1-25-28-10-6-7-11-33(28)45-39(2,35(25)40)29-24-27(36)12-13-30(29)44-21-9-8-15-37-17-19-38(20-18-37)16-14-26-22-31(41-3)34(43-5)32(23-26)42-4/h6-7,10-13,22-25H,8-9,14-21H2,1-5H3/q+1 |
| InChIKey | JLXNYIQUQRRFRK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.28 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|