C17H17ClNO2S+ — CID 23317442
2-(5-chloro-2-methoxyphenyl)-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one (PubChem CID 23317442) has the molecular formula C17H17ClNO2S+ and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one |
|---|---|
| PubChem CID | 23317442 |
| Molecular Formula | C17H17ClNO2S+ |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one |
| SMILES | COc1ccc(Cl)cc1[N+]1(C)Sc2ccccc2C(C)C1=O |
| InChI | InChI=1S/C17H17ClNO2S/c1-11-13-6-4-5-7-16(13)22-19(2,17(11)20)14-10-12(18)8-9-15(14)21-3/h4-11H,1-3H3/q+1 |
| InChIKey | CKTNNKKJOJPBJH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|