C20H24NO3S+ — CID 70409657
2-[2-(4-hydroxybutoxy)phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one (PubChem CID 70409657) has the molecular formula C20H24NO3S+ and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[2-(4-hydroxybutoxy)phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one.
| Compound Name | 2-[2-(4-hydroxybutoxy)phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one |
|---|---|
| PubChem CID | 70409657 |
| Molecular Formula | C20H24NO3S+ |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[2-(4-hydroxybutoxy)phenyl]-2,4-dimethyl-4H-1,2-benzothiazin-2-ium-3-one |
| SMILES | CC1C(=O)[N+](C)(c2ccccc2OCCCCO)Sc2ccccc21 |
| InChI | InChI=1S/C20H24NO3S/c1-15-16-9-3-6-12-19(16)25-21(2,20(15)23)17-10-4-5-11-18(17)24-14-8-7-13-22/h3-6,9-12,15,22H,7-8,13-14H2,1-2H3/q+1 |
| InChIKey | NTBIVJSHUSRPPR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|