C19H20O3S — CID 23321226
3-[(4-butan-2-ylsulfanylphenoxy)methyl]-1,4-benzodioxine (PubChem CID 23321226) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is 3-[(4-butan-2-ylsulfanylphenoxy)methyl]-1,4-benzodioxine.
| Compound Name | 3-[(4-butan-2-ylsulfanylphenoxy)methyl]-1,4-benzodioxine |
|---|---|
| PubChem CID | 23321226 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-[(4-butan-2-ylsulfanylphenoxy)methyl]-1,4-benzodioxine |
| SMILES | CCC(C)Sc1ccc(OCC2=COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C19H20O3S/c1-3-14(2)23-17-10-8-15(9-11-17)20-12-16-13-21-18-6-4-5-7-19(18)22-16/h4-11,13-14H,3,12H2,1-2H3 |
| InChIKey | SEGOATZPMVORGN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |