C25H34Br2O3S — CID 57065290
1-butan-2-yloxy-4-[2,4-dibromo-3-(4-butan-2-ylsulfanylphenoxy)-2-methylbutoxy]benzene (PubChem CID 57065290) has the molecular formula C25H34Br2O3S and a molecular weight of 574.42 g/mol. Its IUPAC name is 1-butan-2-yloxy-4-[2,4-dibromo-3-(4-butan-2-ylsulfanylphenoxy)-2-methylbutoxy]benzene.
| Compound Name | 1-butan-2-yloxy-4-[2,4-dibromo-3-(4-butan-2-ylsulfanylphenoxy)-2-methylbutoxy]benzene |
|---|---|
| PubChem CID | 57065290 |
| Molecular Formula | C25H34Br2O3S |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 1-butan-2-yloxy-4-[2,4-dibromo-3-(4-butan-2-ylsulfanylphenoxy)-2-methylbutoxy]benzene |
| SMILES | CCC(C)Oc1ccc(OCC(C)(Br)C(CBr)Oc2ccc(SC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C25H34Br2O3S/c1-6-18(3)29-21-10-8-20(9-11-21)28-17-25(5,27)24(16-26)30-22-12-14-23(15-13-22)31-19(4)7-2/h8-15,18-19,24H,6-7,16-17H2,1-5H3 |
| InChIKey | TUHSEVPWXKGOAC-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|