About 1-hydroperoxy-4,6-dimethylnonane
1-hydroperoxy-4,6-dimethylnonane (PubChem CID 23324423) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-hydroperoxy-4,6-dimethylnonane.
Molecular Properties
| Compound Name | 1-hydroperoxy-4,6-dimethylnonane |
| PubChem CID | 23324423 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 1-hydroperoxy-4,6-dimethylnonane |
| SMILES | CCCC(C)CC(C)CCCOO |
| InChI | InChI=1S/C11H24O2/c1-4-6-10(2)9-11(3)7-5-8-13-12/h10-12H,4-9H2,1-3H3 |
| InChIKey | MSRBZKLTLWVQMW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroperoxy-4,6-dimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroperoxy-4,6-dimethylnonane?
The IUPAC name of 1-hydroperoxy-4,6-dimethylnonane (CID 23324423) is 1-hydroperoxy-4,6-dimethylnonane.
What is the SMILES notation for 1-hydroperoxy-4,6-dimethylnonane?
The canonical SMILES for 1-hydroperoxy-4,6-dimethylnonane is CCCC(C)CC(C)CCCOO.
What is the InChIKey of 1-hydroperoxy-4,6-dimethylnonane?
The InChIKey is MSRBZKLTLWVQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2/c1-4-6-10(2)9-11(3)7-5-8-13-12/h10-12H,4-9H2,1-3H3.
What are the key properties of 1-hydroperoxy-4,6-dimethylnonane?
1-hydroperoxy-4,6-dimethylnonane has a molecular weight of 188.31 g/mol, XLogP of 3.72, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroperoxy-4,6-dimethylnonane is sourced from PubChem (CID 23324423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).