C22H36OS — CID 23326566
2-[5-[2-(4-methylpentyl)phenyl]sulfanylpentyl]oxane (PubChem CID 23326566) has the molecular formula C22H36OS and a molecular weight of 348.60 g/mol. Its IUPAC name is 2-[5-[2-(4-methylpentyl)phenyl]sulfanylpentyl]oxane.
| Compound Name | 2-[5-[2-(4-methylpentyl)phenyl]sulfanylpentyl]oxane |
|---|---|
| PubChem CID | 23326566 |
| Molecular Formula | C22H36OS |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 2-[5-[2-(4-methylpentyl)phenyl]sulfanylpentyl]oxane |
| SMILES | CC(C)CCCc1ccccc1SCCCCCC1CCCCO1 |
| InChI | InChI=1S/C22H36OS/c1-19(2)11-10-13-20-12-5-6-16-22(20)24-18-9-3-4-14-21-15-7-8-17-23-21/h5-6,12,16,19,21H,3-4,7-11,13-15,17-18H2,1-2H3 |
| InChIKey | RGHZYRGMYJTHEM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|