C19H34O2Si — CID 23327744
tert-butyl-dimethyl-[[(1S,9S,10S)-13-oxatricyclo[8.2.1.01,6]tridec-6-en-9-yl]methoxy]silane (PubChem CID 23327744) has the molecular formula C19H34O2Si and a molecular weight of 322.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,9S,10S)-13-oxatricyclo[8.2.1.01,6]tridec-6-en-9-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,9S,10S)-13-oxatricyclo[8.2.1.01,6]tridec-6-en-9-yl]methoxy]silane |
|---|---|
| PubChem CID | 23327744 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,9S,10S)-13-oxatricyclo[8.2.1.01,6]tridec-6-en-9-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC=C2CCCC[C@]23CC[C@@H]1O3 |
| InChI | InChI=1S/C19H34O2Si/c1-18(2,3)22(4,5)20-14-15-9-10-16-8-6-7-12-19(16)13-11-17(15)21-19/h10,15,17H,6-9,11-14H2,1-5H3/t15-,17-,19-/m0/s1 |
| InChIKey | IMIHGRCPSUBJCU-IEZWGBDMSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|