About 2-cyano-2,2-dinitroacetate
2-cyano-2,2-dinitroacetate (PubChem CID 23331492) has the molecular formula C3N3O6-
and a molecular weight of 174.05 g/mol. Its IUPAC name is 2-cyano-2,2-dinitroacetate.
Molecular Properties
| Compound Name | 2-cyano-2,2-dinitroacetate |
| PubChem CID | 23331492 |
| Molecular Formula | C3N3O6- |
| Molecular Weight | 174.05 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 2-cyano-2,2-dinitroacetate |
| SMILES | N#CC(C(=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C3HN3O6/c4-1-3(2(7)8,5(9)10)6(11)12/h(H,7,8)/p-1 |
| InChIKey | ZBYUHVXHWOWXEN-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 150.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.05 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-2,2-dinitroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-2,2-dinitroacetate?
The IUPAC name of 2-cyano-2,2-dinitroacetate (CID 23331492) is 2-cyano-2,2-dinitroacetate.
What is the SMILES notation for 2-cyano-2,2-dinitroacetate?
The canonical SMILES for 2-cyano-2,2-dinitroacetate is N#CC(C(=O)[O-])([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-cyano-2,2-dinitroacetate?
The InChIKey is ZBYUHVXHWOWXEN-UHFFFAOYSA-M. The full InChI is InChI=1S/C3HN3O6/c4-1-3(2(7)8,5(9)10)6(11)12/h(H,7,8)/p-1.
What are the key properties of 2-cyano-2,2-dinitroacetate?
2-cyano-2,2-dinitroacetate has a molecular weight of 174.05 g/mol, XLogP of -2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-2,2-dinitroacetate is sourced from PubChem (CID 23331492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).