C18H17NO3 — CID 23333604
ethyl 2-(11-oxo-5,6-dihydrobenzo[c][1]benzazepin-2-yl)acetate (PubChem CID 23333604) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 2-(11-oxo-5,6-dihydrobenzo[c][1]benzazepin-2-yl)acetate.
| Compound Name | ethyl 2-(11-oxo-5,6-dihydrobenzo[c][1]benzazepin-2-yl)acetate |
|---|---|
| PubChem CID | 23333604 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethyl 2-(11-oxo-5,6-dihydrobenzo[c][1]benzazepin-2-yl)acetate |
| SMILES | CCOC(=O)Cc1ccc2c(c1)C(=O)c1ccccc1CN2 |
| InChI | InChI=1S/C18H17NO3/c1-2-22-17(20)10-12-7-8-16-15(9-12)18(21)14-6-4-3-5-13(14)11-19-16/h3-9,19H,2,10-11H2,1H3 |
| InChIKey | LJPWROLANCXOHS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|