About 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline
10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline (PubChem CID 23336443) has the molecular formula C21H24ClN3
and a molecular weight of 353.90 g/mol. Its IUPAC name is 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline.
Molecular Properties
| Compound Name | 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline |
| PubChem CID | 23336443 |
| Molecular Formula | C21H24ClN3 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline |
| SMILES | CCCCN1C2=NCCN2C(c2ccccc2)c2cc(C)c(Cl)cc21 |
| InChI | InChI=1S/C21H24ClN3/c1-3-4-11-24-19-14-18(22)15(2)13-17(19)20(16-8-6-5-7-9-16)25-12-10-23-21(24)25/h5-9,13-14,20H,3-4,10-12H2,1-2H3 |
| InChIKey | KGIPDMVZTYZHSH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline?
The IUPAC name of 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline (CID 23336443) is 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline.
What is the SMILES notation for 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline?
The canonical SMILES for 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline is CCCCN1C2=NCCN2C(c2ccccc2)c2cc(C)c(Cl)cc21.
What is the InChIKey of 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline?
The InChIKey is KGIPDMVZTYZHSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24ClN3/c1-3-4-11-24-19-14-18(22)15(2)13-17(19)20(16-8-6-5-7-9-16)25-12-10-23-21(24)25/h5-9,13-14,20H,3-4,10-12H2,1-2H3.
What are the key properties of 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline?
10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline has a molecular weight of 353.90 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-butyl-8-chloro-7-methyl-5-phenyl-3,5-dihydro-2H-imidazo[2,1-b]quinazoline is sourced from PubChem (CID 23336443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).