About N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline
N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline (PubChem CID 57061916) has the molecular formula C21H25Cl2N3
and a molecular weight of 390.36 g/mol. Its IUPAC name is N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline.
Molecular Properties
| Compound Name | N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline |
| PubChem CID | 57061916 |
| Molecular Formula | C21H25Cl2N3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline |
| SMILES | CCCCN1CCN=C1CN(Cc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H25Cl2N3/c1-2-3-12-25-13-11-24-21(25)16-26(15-17-7-5-4-6-8-17)20-10-9-18(22)14-19(20)23/h4-10,14H,2-3,11-13,15-16H2,1H3 |
| InChIKey | GRFZXVYCZGYNMR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline?
The IUPAC name of N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline (CID 57061916) is N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline.
What is the SMILES notation for N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline?
The canonical SMILES for N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline is CCCCN1CCN=C1CN(Cc1ccccc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline?
The InChIKey is GRFZXVYCZGYNMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25Cl2N3/c1-2-3-12-25-13-11-24-21(25)16-26(15-17-7-5-4-6-8-17)20-10-9-18(22)14-19(20)23/h4-10,14H,2-3,11-13,15-16H2,1H3.
What are the key properties of N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline?
N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline has a molecular weight of 390.36 g/mol, XLogP of 5.51, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(1-butyl-4,5-dihydroimidazol-2-yl)methyl]-2,4-dichloroaniline is sourced from PubChem (CID 57061916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).