C27H22N4O4 — CID 2333862
3-[(4Z)-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]propanoic acid (PubChem CID 2333862) has the molecular formula C27H22N4O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 3-[(4Z)-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]propanoic acid.
| Compound Name | 3-[(4Z)-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 2333862 |
| Molecular Formula | C27H22N4O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 3-[(4Z)-4-[[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]propanoic acid |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=C2\C(=O)N(CCC(=O)O)N=C2c2ccccc2)o1 |
| InChI | InChI=1S/C27H22N4O4/c1-18-12-13-23(35-18)26-20(17-31(29-26)21-10-6-3-7-11-21)16-22-25(19-8-4-2-5-9-19)28-30(27(22)34)15-14-24(32)33/h2-13,16-17H,14-15H2,1H3,(H,32,33)/b22-16- |
| InChIKey | TZHNEDJWWBSTNE-JWGURIENSA-N |
| XLogP | 4.55 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|