C23H23NO2 — CID 23344318
N-benzyl-2-(2-hydroxypropyl)-6-phenylbenzamide (PubChem CID 23344318) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-benzyl-2-(2-hydroxypropyl)-6-phenylbenzamide.
| Compound Name | N-benzyl-2-(2-hydroxypropyl)-6-phenylbenzamide |
|---|---|
| PubChem CID | 23344318 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-benzyl-2-(2-hydroxypropyl)-6-phenylbenzamide |
| SMILES | CC(O)Cc1cccc(-c2ccccc2)c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c1-17(25)15-20-13-8-14-21(19-11-6-3-7-12-19)22(20)23(26)24-16-18-9-4-2-5-10-18/h2-14,17,25H,15-16H2,1H3,(H,24,26) |
| InChIKey | MWJDKKSENIEQGC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |