C11H15IO7S — CID 23357108
2-iodosyl-5-[2-(2-methoxyethoxy)ethoxy]benzenesulfonic acid (PubChem CID 23357108) has the molecular formula C11H15IO7S and a molecular weight of 418.21 g/mol. Its IUPAC name is 2-iodosyl-5-[2-(2-methoxyethoxy)ethoxy]benzenesulfonic acid.
| Compound Name | 2-iodosyl-5-[2-(2-methoxyethoxy)ethoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 23357108 |
| Molecular Formula | C11H15IO7S |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 2-iodosyl-5-[2-(2-methoxyethoxy)ethoxy]benzenesulfonic acid |
| SMILES | COCCOCCOc1ccc(I=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H15IO7S/c1-17-4-5-18-6-7-19-9-2-3-10(12-13)11(8-9)20(14,15)16/h2-3,8H,4-7H2,1H3,(H,14,15,16) |
| InChIKey | VUTQJYXQCVWYSA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|